සැකිල්ල:Infobox drug/testcases5 සඳහා මුලාශ්‍රය නරඹන්න

පහත හේතුව නිසා, ඔබ හට මෙම පිටුව සංස්කරණය කරන්න සඳහා අවසර නොමැත:

Your IP address is in a range that has been blocked on all Wikimedia Foundation wikis.

The block was made by ‪EPIC‬. The reason given is Open proxy/Webhost: See the help page if you are affected.

Start of block: 08:48, 2 ජූලි 2024
Expiry of block: 08:48, 2 ජූලි 2025

Your current IP address is 206.189.44.186. The blocked range is 206.189.32.0/20.

Please include all above details in any queries you make. If you believe you were blocked by mistake, you can find additional information and instructions in the No open proxies global policy.

Otherwise, to discuss the block please post a request for review on Meta-Wiki. You could also send an email to the stewards VRT queue at stewards@wikimedia.org including all above details.

මෙම පිටුවෙහි මූලාශ්‍රය නැරඹීමට හා පිටපත් කිරීමට ඔබ හට හැකිය.

{{Testcases notice}}
{{Drugbox/testcases/navbox}}

==Drugbank==
:URl change 2021-01-27
:{{t links|Infobox drug/formatDrugBank/sandbox}}
:{{t links|DrugBank/sandbox}}

==UNII==
:Dec 2020: talk [https://en.wikipedia.org/w/index.php?title=Template_talk:Infobox_drug&type=revision&diff=994506680&oldid=993712202&diffmode=source]
[[Aspirin]] R16CO5Y76E
:{{t links|Infobox drug/formatUNII}}

:{{Infobox drug/formatUNII|localValue=R16CO5Y76E}}

;sandbox
:{{Infobox drug/formatUNII/sandbox|localValue=R16CO5Y76E}}

==PDB ligand==
:Oct 2020, [[Template_talk:Infobox_drug#PDB]]
{{testcase table
| drug_name         = [[Valganciclovir]]
| image = Valganciclovir structure.svg

<!-- Clinical data -->

<!-- Identifiers -->
| index2_label = [test]
| CAS_number = 175865-60-8
| CAS_supplemental  = 
| PubChem = 135413535
| IUPHAR_ligand = 4716
| DrugBank = DB01610
| ChemSpiderID = 57721
| UNII = GCU97FKN3R
| KEGG = D02495
| KEGG2 = D03256
| ChEBI             = 
| ChEMBL = 1201314
| NIAID_ChemDB = 032967
| PDB_ligand        = F9E
| PDB_ligand2       = TYL

<!-- Chemical and physical data -->

| SMILES = O=C(OCC(OCn1c2N\C(=N/C(=O)c2nc1)N)CO)[C@@H](N)C(C)C
| StdInChI = 1S/C14H22N6O5/c1-7(2)9(15)13(23)24-4-8(3-21)25-6-20-5-17-10-11(20)18-14(16)19-12(10)22/h5,7-9,21H,3-4,6,15H2,1-2H3,(H3,16,18,19,22)/t8?,9-/m0/s1
| StdInChIKey = WPVFJKSGQUFQAP-GKAPJAKFSA-N
}}

==KEGG==
{{testcase table
| drug_name = ID's
| Verifiedfields = changed
| verifiedrevid = 415028406
<!--Identifiers-->
| CAS_number_Ref =
| CAS_number = 165800-03-3
| DrugBank = 
| DrugBank_Ref =
| ChemSpiderID_Ref =
| ChemSpiderID = 390139
| UNII_Ref =
| UNII = ISQ9I6J12J
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00947
| ChEMBL_Ref =
| ChEMBL = 126
| ChEBI_Ref =
| ChEBI = 127

| smiles = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = TYZROVQLWOKYKF-ZDUSSCGKSA-N

<!--NOT verif-->
| ATC_prefix = J01
| ATC_suffix = XX08
| NIAID_ChemDB = 070944
| PDB_ligand = ZLD
 |PubChem=4091
 |PubChemSubstance=10099
}}

== Test 1 ==
{{testcase table
| drug_name = ID's
| Verifiedfields = changed
| verifiedrevid = 415028406
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 165800-03-3
| DrugBank = DB00601
| DrugBank_Ref = {{drugbankcite|monkey|??}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 390139
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ISQ9I6J12J
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00947
| ChEMBL_Ref = {{ebicite|correct|EBI1}}
| ChEMBL = 126
| ChEBI_Ref = {{ebicite|correct|EBI2}}
| ChEBI = 127

| smiles = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = TYZROVQLWOKYKF-ZDUSSCGKSA-N

<!--NOT verif-->
| ATC_prefix = J01
| ATC_suffix = XX08
| NIAID_ChemDB = 070944
| PDB_ligand = ZLD
 |PubChem=4091
 |PubChemSubstance=10099
}}

== id's indexed &lt;blank>,2 with index 0, 2==
{{purge}}
{{testcase table

| index_label=ix0
| index2_label=ix2
| index_comment=Some general note about index_label
| index2_comment=Some general note about index2_label

| IUPAC_name =Aaa
| IUPAC_name2 =Bbb
| drug_name = ID's with index2_label

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 165800-03-3
| CAS_number2 = 165800-03-2
| DrugBank = DB00601
| DrugBank2 = DB00602
| DrugBank_Ref = {{drugbankcite|monkey|??}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 390139
| ChemSpiderID2 = 390132
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ISQ9I6J12J
| UNII2 = ISQ9I6J122
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00947
| KEGG2 = D00942
| ChEMBL_Ref = {{ebicite|correct|EBI1}}
| ChEMBL = 126
| ChEMBL2 = 1262
| ChEBI_Ref = {{ebicite|correct|EBI2}}
| ChEBI = 127
| ChEBI2 = 1272
| IUPHAR_ligand = 1133
| IUPHAR_ligand2 = 1132

| SMILES = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
| SMILES2 = O=C22[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = TYZROVQLWOKYKF-ZDUSSCGKSA-N

| StdInChI2 = 1S/22C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s2
| StdInChIKey2 = 22ZROVQLWOKYKF-ZDUSSCGKSA-2

<!--NOT verif-->
| ATC_prefix = J01
| ATC_suffix = XX08
| ATC_prefix2 = J02
| ATC_suffix2 = XX02

| NIAID_ChemDB = 070944
| NIAID_ChemDB2 = 070922

| PDB_ligand = ZLD
| PDB_ligand2 = ZLD2

| PubChem=4091
| PubChem2=4092
| PubChemSubstance=10099

| E_number=E111
| E_number2=E222
}}

== index-2 ==
{{purge}}
{{testcase table
| IUPAC_name =Aaa
| IUPAC_name2 =Bbb
| drug_name = ID's with index2_label

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 165800-03-3
| CAS_number2 = 165800-03-2
| DrugBank = DB00601
| DrugBank2 = DB00602
| DrugBank_Ref = {{drugbankcite|monkey|??}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 390139
| ChemSpiderID2 = 390132
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ISQ9I6J12J
| UNII2 = ISQ9I6J122
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00947
| KEGG2 = D00942
| ChEMBL_Ref = {{ebicite|correct|EBI1}}
| ChEMBL = 126
| ChEMBL2 = 1262
| ChEBI_Ref = {{ebicite|correct|EBI2}}
| ChEBI = 127
| ChEBI2 = 1272
| IUPHAR_ligand = 1133
| IUPHAR_ligand2 = 1132

| SMILES = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
| SMILES2 = O=C22[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = TYZROVQLWOKYKF-ZDUSSCGKSA-N

| StdInChI2 = 1S/22C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s2
| StdInChIKey2 = 22ZROVQLWOKYKF-ZDUSSCGKSA-2

<!--NOT verif-->
| ATC_prefix = J01
| ATC_suffix = XX08
| ATC_prefix2 = J02
| ATC_suffix2 = XX02

| NIAID_ChemDB = 070944
| NIAID_ChemDB2 = 070922

| PDB_ligand = ZLD
| PDB_ligand2 = ZLD2

| PubChem=4091
| PubChem2=4092
| PubChemSubstance=10099

| E_number=E111
| E_number2=E222
}}

== index-2 only ==
{{purge}}
{{testcase table
| IUPAC_name2 =Bbb
| drug_name = ID's with index2_label
| index2_label=Indx2
<!--Identifiers-->
| CAS_number2 = 165800-03-2
| DrugBank2 = DB00602
| ChemSpiderID2 = 390132
| UNII2 = ISQ9I6J122
| KEGG2 = D00942
| ChEMBL2 = 1262
| ChEBI2 = 1272
| IUPHAR_ligand2 = 1132

| SMILES2 = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc2
| StdInChI2 = 1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s2
| StdInChIKey2 = TYZROVQLWOKYKF-ZDUSSCGKSA-2

<!--NOT verif-->
| ATC_prefix2 = J01
| ATC_suffix2 = XX08
| NIAID_ChemDB2 = 070942
| PDB_ligand2 = ZLD2
| PubChem2=4092

}}

==Linalool==
===Chembox===
{{clear}}
<div style="float:left">
<br>
:{{para|index_label|}}
:{{para|index1_label|(''R'')}}
:{{para|index2_label|(''S'')}}
</div>
<div style="float:right;">
:{{para|CASNo1_Comment | (''R'')}}
:{{para|PubChem1_Comment | (''R'')}}
:{{para|CASNo2_Comment | (''S'')}}
:{{para|PubChem2_Comment | (''S'')}}
</div>
{{clear}}
<div style="float:left">
{{chembox
|Name=Linalool (sandbox)
|Section1={{Chembox Identifiers/sandbox
| index_label =
| index1_label = (''R'')
| index2_label = (''S'')
| IUPHAR_ligand = 2469
| CASNo = 78-70-6
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 126-91-0
| CASNo1_Comment = 
| CASNo1_Ref = {{cascite|changed|CAS}}
| CASNo2 = 126-90-9
| CASNo2_Comment =
| CASNo2_Ref = {{cascite|changed|CAS}}
| PubChem = 6549
| PubChem1 = 443158
| PubChem1_Comment =
| PubChem2 = 67179
| PubChem2_Comment =  }}
| show_ss_note =no | show_infobox_ref =no
}}
</div>

{{chembox
|Name=[[Linalool]] (live version)
|Section1={{Chembox Identifiers
| index_label =
| index1_label = (''R'')
| index2_label = (''S'')
| IUPHAR_ligand = 2469
| CASNo = 78-70-6
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 126-91-0
| CASNo1_Comment = (''R'')
| CASNo1_Ref = {{cascite|changed|CAS}}
| CASNo2 = 126-90-9
| CASNo2_Comment = (''S'')
| CASNo2_Ref = {{cascite|changed|CAS}}
| PubChem = 6549
| PubChem1 = 443158
| PubChem1_Comment = (''R'')
| PubChem2 = 67179
| PubChem2_Comment = (''S'')  }}
| show_ss_note =no | show_infobox_ref =no
}}
{{clear}}
: {{Q|Q410932}}, {{Q|Q27105233}}, {{Q|Q27105200}}
===Linalool by drugbox===
:index1 (''R''): skipped/unused
{{testcase table
|index_label=
|index1_label=(''R'')
|index2_label=(''S'')
|QID=Q410932
|QID1=Q27105233
|QID2=Q27105200
| IUPHAR_ligand = 2469
| CAS_number  = 78-70-6
| CAS_number1 = 126-91-0
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number2 = 126-90-9
| CAS_number2_Ref = {{cascite|changed|CAS}}
| PubChem = 6549
| PubChem1 = 443158
| PubChem2 = 67179
}}

== Test 2 ==
:SID and CID
{{testcase table
| drug_name = ID's
| Verifiedfields = changed
| verifiedrevid = 415028406

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 165800-03-3
<!--NOT verif-->
| ATC_prefix = J01
| ATC_suffix = XX08
| PubChem = 441401
| PubChemStructure=9999
| NIAID_ChemDB = 070944
| PDB_ligand = ZLD
<!-- |PubChem=4091-->
 |PubChemSubstance=10099
}}

==data page==
:{{para|data_page}} or exists, demo page = ???
{{testcase table
| drug_name = data page

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 165800-03-3
<!-- data page-->
| data_page= [[Main page|some page]]
}}

==CAS = none ==
:{{para|CAS_number|none}}

{{testcase table
| drug_name = regular cas
<!--Identifiers-->
| CAS_number = 165800-03-3
| CAS_number_Ref = {{cascite|correct|??}}
}}

{{testcase table
| drug_name = cas none 
<!--Identifiers-->
| CAS_number = None
| CAS_number_Ref = {{cascite|correct|??}}
}}

{{testcase table
| drug_name = cas none 
<!--Identifiers-->
| CAS_number = None
| CAS_number2 = None
| CAS_number_Ref = {{cascite|correct|??}}
}}


{{testcase table
| drug_name = cas blank
<!--Identifiers-->
| CAS_number = 
| CAS_number_Ref = {{cascite|correct|??}}
}}

==PubChem = none ==
:{{para|PubChem|none}}

{{testcase table
| drug_name = regular pubchem 
<!--Identifiers-->
| PubChem = 1234
}}

{{testcase table
| drug_name = pubchem none 
<!--Identifiers-->
| PubChem = None
}}
{{testcase table
| drug_name = pubchem2 none 
<!--Identifiers-->
| PubChem = None
| PubChem2 = none
}}

{{testcase table
| drug_name = pubchem  blank
<!--Identifiers-->
| PubChem  = 

}}

==ChemSpider = none ==

:{{para|ChemSpiderID|none}} does cat, and show.

{{testcase table
| drug_name = deprecated chemspider =NA
<!--Identifiers FEB 2017-->
| ChemSpiderID = Na
}}


{{testcase table
| drug_name = regular chemspider 
<!--Identifiers-->
| ChemSpiderID = 1234
}}

{{testcase table
| drug_name = rgular 2
<!--Identifiers-->
| index_label=ix0
| index2_label=ix2
| ChemSpiderID = 789
| ChemSpiderID2 = 123
}}
{{testcase table
| drug_name = Chemspider none 
<!--Identifiers-->
| ChemSpiderID = None
}}

{{testcase table
| drug_name = 2 none 
<!--Identifiers-->
| index_label=ix0
| index2_label=ix2
| ChemSpiderID = None
| ChemSpiderID2 = 123
}}
{{testcase table
| drug_name = 2 none 
<!--Identifiers-->
| index_label=ix0
| index2_label=ix2

| ChemSpiderID = None
| ChemSpiderID2 = none
}}

{{testcase table
| drug_name = chemspider  blank
<!--Identifiers-->
| ChemSpiderID  = 
| index_label=ix0
| index2_label=ix2

}}
[http://www.example.com link title]

==Jmol==
1. By default, the Jmol external link is fed with the {{para|SMILES}} input. So {{para|Jmol}} does not need input.

2. When {{para|Jmol|none}}, the Jmol data row is suppressed (not shown).

3. When {{para|Jmol|&lt;some SMILES string>}}, Jmol links will show ''that'' string in 3D, no matter what {{para|SMILES}} is. (SMILES output itself is unchanged).

{{testcase table
| drug_name = 1.Jmol by smiles (default)
<!--Identifiers-->
| smiles = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
}}

{{testcase table
| drug_name = 2.Jmol=none
<!--Identifiers-->
| smiles = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
| Jmol = none
}}

{{testcase table
| drug_name = 3.Jmol=[[DDT]] (overwrites SMILES)
<!--Identifiers-->
| smiles = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
| Jmol=Clc1ccc(cc1)C(c2ccc(Cl)cc2)C(Cl)(Cl)Cl
}}

{{testcase table
| drug_name = 4.Jmol only
<!--Identifiers-->
| Jmol=Clc1ccc(cc1)C(c2ccc(Cl)cc2)C(Cl)(Cl)Cl
}}

===Jmol (secondary tests)===

{{testcase table
| drug_name = no input
<!--Identifiers-->
| smiles =
}}

{{testcase table
| drug_name = Jmol=None
<!--Identifiers-->
| smiles = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
| Jmol = None
}}

{{testcase table
| drug_name = SMILES2 input
<!--Identifiers-->
| smiles2 = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
}}

මෙම පිටුවෙහි භාවිත සැකිලි:

සැකිල්ල:Infobox drug/testcases5 වෙත නැවත යන්න.

"https://si.wikipedia.org/wiki/සැකිල්ල:Infobox_drug/testcases5" වෙතින් සම්ප්‍රවේශනය කෙරිණි