ඇටෝවෙස්ටාටන් සඳහා මුලාශ්‍රය නරඹන්න

පහත හේතුව නිසා, ඔබ හට මෙම පිටුව සංස්කරණය කරන්න සඳහා අවසර නොමැත:

Your IP address is in a range that has been blocked on all Wikimedia Foundation wikis.

The block was made by ‪EPIC‬. The reason given is Open proxy/Webhost: See the help page if you are affected.

Start of block: 08:48, 2 ජූලි 2024
Expiry of block: 08:48, 2 ජූලි 2025

Your current IP address is 206.189.44.186. The blocked range is 206.189.32.0/20.

Please include all above details in any queries you make. If you believe you were blocked by mistake, you can find additional information and instructions in the No open proxies global policy.

Otherwise, to discuss the block please post a request for review on Meta-Wiki. You could also send an email to the stewards VRT queue at stewards@wikimedia.org including all above details.

මෙම පිටුවෙහි මූලාශ්‍රය නැරඹීමට හා පිටපත් කිරීමට ඔබ හට හැකිය.

{{cs1 config |name-list-style=vanc |display-authors=6}}
{{Infobox drug
| Verifiedfields =
| Watchedfields = changed
| verifiedrevid = 477861573
| image = Atorvastatin.svg
| width = 275
| alt               = 
| image2 = Atorvastatin-from-xtal-3D-bs-17.png
| width2 = 250
| alt2              = 
| caption           =

<!-- Clinical data -->
| pronounce = {{IPAc-en|ə|ˌ|t|ɔr|v|ə|ˈ|s|t|æ|t|ən}}
| tradename = Lipitor, others
| Drugs.com = {{drugs.com|monograph|lipitor}}
| MedlinePlus = a600045
| DailyMedID        = Atorvastatin
| pregnancy_AU = D
| pregnancy_AU_comment = <ref name="Drugs.com pregnancy">{{cite web | title=Atorvastatin (Lipitor) Use During Pregnancy | website=Drugs.com | date=3 February 2020 | url=https://www.drugs.com/pregnancy/atorvastatin.html | access-date=26 February 2020 | archive-date=4 December 2019 | archive-url=https://web.archive.org/web/20191204214758/https://www.drugs.com/pregnancy/atorvastatin.html | url-status=live }}</ref>
| pregnancy_category= Contraindicated<ref name="Drugs.com pregnancy" />
| routes_of_administration = [[Oral administration|By mouth]]
| class             = 
| ATC_prefix = C10
| ATC_suffix = AA05
| ATC_supplemental  = {{ATC|C10|BX08}} {{ATC|C10|BX03}} {{ATC|C10|BA05}} {{ATC|C10|BA08}} {{ATC|C10|BX15}} {{ATC|C10|BX12}} {{ATC|C10|BX06}} {{ATC|C10|BX11}}

<!-- Legal status -->
| legal_AU = S4
| legal_AU_comment = <ref>{{cite web | title=Prescription medicines: registration of new generic medicines and biosimilar medicines, 2017 | website=Therapeutic Goods Administration (TGA) | date=21 June 2022 | url=https://www.tga.gov.au/resources/publication/publications/prescription-medicines-registration-new-generic-medicines-and-biosimilar-medicines-2017 | access-date=30 March 2024}}</ref>
| legal_BR =  <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F-->
| legal_BR_comment = 
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA_comment = 
| legal_DE = <!-- Anlage I, II, III or Unscheduled-->
| legal_DE_comment = 
| legal_NZ = <!-- Class A, B, C -->
| legal_NZ_comment = 
| legal_UK = POM
| legal_UK_comment = 
| legal_US = Rx-only
| legal_US_comment = <ref name="Lipitor label" />
| legal_EU = Rx-only
| legal_EU_comment = {{cite web | title=Lipitor | website=European Medicines Agency | date=17 September 2018 | url=https://www.ema.europa.eu/en/medicines/human/referrals/lipitor | access-date=26 February 2023}}</ref>
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV-->
| legal_UN_comment = 
| legal_status      = <!--For countries not listed above-->

<!-- Pharmacokinetic data -->
| bioavailability = 12%
| protein_bound     = 
| metabolism = [[Liver]] ([[CYP3A4]])
| metabolites       = 
| onset             = 
| elimination_half-life = 14 hours
| duration_of_action = 
| excretion = [[Bile duct]]

<!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 134523-00-5
| CAS_supplemental  = 
| PubChem = 60823
| IUPHAR_ligand = 2949
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = APRD00055
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 54810
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = A0JWA85V8F
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07474
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 39548
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1487
| NIAID_ChemDB      = 
| PDB_ligand = 117
| synonyms          =

<!-- Chemical and physical data -->
| IUPAC_name = (3''R'',5''R'')-7-[2-(4-Fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid
| C=33 | H=35 | F=1 | N=2| O=5
| SMILES = O=C(O)C[C@H](O)C[C@H](O)CCn2c(c(c(c2c1ccc(F)cc1)c3ccccc3)C(=O)Nc4ccccc4)C(C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C33H35FN2O5/c1-21(2)31-30(33(41)35-25-11-7-4-8-12-25)29(22-9-5-3-6-10-22)32(23-13-15-24(34)16-14-23)36(31)18-17-26(37)19-27(38)20-28(39)40/h3-16,21,26-27,37-38H,17-20H2,1-2H3,(H,35,41)(H,39,40)/t26-,27-/m1/s1
| StdInChI_comment  = 
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XUKUURHRXDUEBC-KAYWLYCHSA-N
| density           = 
| density_notes     = 
| melting_point     = 
| melting_high      = 
| melting_notes     = 
| boiling_point     = 
| boiling_notes     = 
| solubility        = 
| sol_units         = 
| specific_rotation = 
}}

'''ඇටෝවෙස්ටාටන්''' ({{en|Atorvastatin}}) යනු [[cardiovascular disease|හෘද රෝග]] වැළැක්වීම සඳහා සහ [[dyslipidemia|අසාමාන්‍ය ලිපිඩ මට්ටම්]] සඳහා ප්‍රතිකාර කිරීමට භාවිතා කරන [[statin|ස්ටැටන්]] කාණ්ඩයේ ඖෂධයකි.<ref name=AHFS2018/> හෘද රෝග වැළැක්වීම සඳහා ස්ටැටන් යනු පළමු පෙළ ප්‍රතිකාරයකි.<ref name=AHFS2018/> මෙය [[by mouth|මුඛ මාර්ගයෙන්]] ගන්නා ඔසුවකි.<ref name=AHFS2018/>

== මූලාශ්‍ර ==
{{Reflist|refs =

<ref name=AHFS2018>{{cite web |title=Atorvastatin Calcium Monograph for Professionals |url=https://www.drugs.com/monograph/atorvastatin-calcium.html |website=Drugs.com |publisher=AHFS |access-date=23 December 2018 |archive-date=25 October 2010 |archive-url=https://web.archive.org/web/20101025140429/https://www.drugs.com/monograph/atorvastatin-calcium.html |url-status=live }}</ref>

<ref name="Lipitor label">{{cite web | title=Lipitor- atorvastatin calcium tablet, film coated | website=DailyMed | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=c6e131fe-e7df-4876-83f7-9156fc4e8228 | access-date=26 February 2020 | archive-date=26 November 2020 | archive-url=https://web.archive.org/web/20201126041933/https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=c6e131fe-e7df-4876-83f7-9156fc4e8228 | url-status=live }}</ref>
}}

{{Statins}}
{{Portal bar | Medicine}}
{{Authority control}}

[[Category:Anilides]]
[[Category:Diols]]
[[Category:Fluoroarenes]]
[[Category:Isopropyl compounds]]
[[Category:Drugs developed by Pfizer]]
[[Category:Pyrroles]]
[[Category:Statins]]

{{med-stub}}

මෙම පිටුවෙහි භාවිත සැකිලි:

ඇටෝවෙස්ටාටන් වෙත නැවත යන්න.

"https://si.wikipedia.org/wiki/ඇටෝවෙස්ටාටන්" වෙතින් සම්ප්‍රවේශනය කෙරිණි